CymitQuimica logo

CAS 110704-45-5

:

1,2,4-Oxadiazole, 5-(chloromethyl)-3-(2-fluorophenyl)-

Description:
1,2,4-Oxadiazole, 5-(chloromethyl)-3-(2-fluorophenyl)-, with CAS number 110704-45-5, is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in its five-membered structure. This compound features a chloromethyl group at the 5-position and a 2-fluorophenyl group at the 3-position, contributing to its unique chemical properties. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity. Generally, oxadiazoles are known for their diverse applications in pharmaceuticals, agrochemicals, and materials science due to their ability to participate in various chemical reactions. The chloromethyl group can serve as a reactive site for further functionalization, making this compound a potential candidate for synthesis in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, which may affect its interactions in biological systems or its utility in synthetic pathways.
Formula:C9H6ClFN2O
InChI:InChI=1S/C9H6ClFN2O/c10-5-8-12-9(13-14-8)6-3-1-2-4-7(6)11/h1-4H,5H2
InChI key:OUTFQFIWFLMIOE-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)C2=NOC(=N2)CCl)F
Found 2 products.