CymitQuimica logo

CAS 1107062-31-6

:

sodium 5-methylthiazole-2-carboxylate

Description:
Sodium 5-methylthiazole-2-carboxylate is a sodium salt derived from 5-methylthiazole-2-carboxylic acid, which features a thiazole ring, a five-membered heterocyclic structure containing sulfur and nitrogen. This compound is characterized by its solubility in water due to the presence of the sodium ion, which enhances its ionic nature. The thiazole moiety contributes to its potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The carboxylate group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. Additionally, the methyl group on the thiazole ring can influence the compound's reactivity and interaction with biological targets. Overall, sodium 5-methylthiazole-2-carboxylate is a versatile compound with potential applications in medicinal chemistry and biochemistry, particularly in the development of novel therapeutic agents or as a biochemical probe.
Formula:C5H4NNaO2S
InChI:InChI=1S/C5H5NO2S.Na/c1-3-2-6-4(9-3)5(7)8;/h2H,1H3,(H,7,8);/q;+1/p-1
InChI key:BFKXLNYVOQXJJG-UHFFFAOYSA-M
SMILES:CC1=CN=C(S1)C(=O)[O-].[Na+]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.