CAS 11075-87-9

Formula: C19H36N2O5

InChI: InChI=1S/C19H36N2O5/c1-15(2)8-7-11-16(23)9-5-3-4-6-10-17(24)12-13-21(26)19(25)18(20)14-22/h15,18,22,26H,3-14,20H2,1-2H3/t18-/m0/s1

InChI key: ILLOYMPJYAVZKU-SFHVURJKSA-N

SMILES: CC(C)CCCC(=O)CCCCCCC(=O)CCN(C(=O)[C@H](CO)N)O

Lipoxamycin (hemisulfate)

CAS: 11075-87-9

Ref: IN-DA009RN9

Lipoxamycin hemisulfate

CAS: 11075-87-9

Lipoxamycin hemisulfate

Formula: C₃₈H₇₄N₄O₁₄S

Purity: ≥98%

Molecular weight: 843.08

Ref: 54-BUP01958

Lipoxamycin (hemisulfate)

CAS: 11075-87-9

Lipoxamycin (hemisulfate) is a complex polyketide acting as an antimicrobial and antitumor agent, derived from a specific strain of soil-derived Actinomycetes. Its mode of action centers on the disruption of protein synthesis, specifically targeting tumor cells by inhibiting key enzymes required for cell growth and replication. The compound's structure, featuring multiple heterocyclic rings and functional groups, allows it to effectively bind to its molecular targets, inducing apoptosis in malignant cells.

Formula: C₃₈H₇₄N₄O₁₄S

Purity: Min. 95%

Molecular weight: 843.1 g/mol

Ref: 3D-LAA07587

Lipoxamycin hemisulfate

CAS: 11075-87-9

Lipoxamycin hemisulfate (Lipoxamycin) is an inhibitor of serine palmitoyltransferase (IC50 = 21 nM) with antifungal activity.

Formula: C₃₈H₇₄N₄O₁₄S

Purity: 99.14% - 99.93%

Color and Shape: Solid

Molecular weight: 843.08

Ref: TM-T26308