CymitQuimica logo

CAS 1107603-52-0

:

B-(4-Butoxy-2-fluorophenyl)boronic acid

Description:
B-(4-Butoxy-2-fluorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. This compound features a butoxy group and a fluorine atom on a phenyl ring, which can influence its reactivity and solubility. The presence of the fluorine atom may enhance the electron-withdrawing properties of the aromatic system, potentially affecting the acidity of the boronic acid group. Typically, boronic acids are solid at room temperature and can be soluble in polar organic solvents. They are often used in organic synthesis, medicinal chemistry, and materials science due to their ability to participate in cross-coupling reactions. Additionally, the specific structural features of B-(4-Butoxy-2-fluorophenyl)boronic acid may impart unique properties that could be exploited in drug development or the synthesis of complex organic molecules.
Formula:C10H14BFO3
InChI:InChI=1S/C10H14BFO3/c1-2-3-6-15-8-4-5-9(11(13)14)10(12)7-8/h4-5,7,13-14H,2-3,6H2,1H3
InChI key:InChIKey=VSRXQUICHOERLV-UHFFFAOYSA-N
SMILES:O(CCCC)C1=CC(F)=C(B(O)O)C=C1
Synonyms:
  • B-(4-Butoxy-2-fluorophenyl)boronic acid
  • Boronic acid, B-(4-butoxy-2-fluorophenyl)-
  • (4-Butoxy-2-fluorophenyl)boronic acid
Found 4 products.