CymitQuimica logo

CAS 1107627-21-3

:

B-(1-Methyl-1H-benzimidazol-5-yl)boronic acid

Description:
B-(1-Methyl-1H-benzimidazol-5-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a 1-methyl-1H-benzimidazole moiety. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and possessing acidic characteristics due to the boronic acid group. It is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the benzimidazole ring contributes to its biological activity, potentially influencing its interactions with biological targets. Additionally, this compound may exhibit fluorescence properties, which can be advantageous in certain analytical applications. Overall, B-(1-Methyl-1H-benzimidazol-5-yl)boronic acid is a versatile compound with significant utility in both research and industrial contexts.
Formula:C8H9BN2O2
InChI:InChI=1S/C8H9BN2O2/c1-11-5-10-7-4-6(9(12)13)2-3-8(7)11/h2-5,12-13H,1H3
InChI key:InChIKey=ULAHHADVEXVVEN-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(B(O)O)=CC2)N=C1
Synonyms:
  • (1-Methyl-1H-benzimidazol-5-yl)boronic acid
  • B-(1-Methyl-1H-benzimidazol-5-yl)boronic acid
  • Boronic acid, B-(1-methyl-1H-benzimidazol-5-yl)-
  • 1-Methylbenzimidazol-5-ylboronic acid
Found 4 products.