CymitQuimica logo

CAS 1107659-78-8

:

3-Pyrrolidinol, 2-methyl-, hydrochloride (1:1), (2S,3S)-

Description:
3-Pyrrolidinol, 2-methyl-, hydrochloride (1:1), (2S,3S)- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a hydroxyl group (-OH) and a methyl group (-CH3) attached to the pyrrolidine ring, contributing to its unique properties. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The (2S,3S) designation refers to its specific stereochemistry, indicating the spatial arrangement of atoms around the chiral centers in the molecule, which can significantly influence its biological activity and interactions. Generally, compounds like this may exhibit properties such as being hygroscopic and having potential uses in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C5H11NO·ClH
InChI:InChI=1S/C5H11NO.ClH/c1-4-5(7)2-3-6-4;/h4-7H,2-3H2,1H3;1H/t4-,5-;/m0./s1
InChI key:InChIKey=CFFLXBUMALVKSD-FHAQVOQBSA-N
SMILES:O[C@@H]1[C@H](C)NCC1.Cl
Synonyms:
  • 3-Pyrrolidinol, 2-methyl-, hydrochloride (1:1), (2S,3S)-
Found 5 products.