CymitQuimica logo

CAS 1107694-73-4

:

2,5-dichloroquinazolin-4-ol

Description:
2,5-Dichloroquinazolin-4-ol is a chemical compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring system. The presence of two chlorine atoms at the 2 and 5 positions of the quinazoline ring contributes to its unique reactivity and potential biological activity. The hydroxyl group (-OH) at the 4-position enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of oncology and antimicrobial research. Its molecular properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, the presence of halogens often affects the compound's electronic properties, making it a candidate for further study in various chemical reactions and applications. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C8H4Cl2N2O
InChI:InChI=1S/C8H4Cl2N2O/c9-4-2-1-3-5-6(4)7(13)12-8(10)11-5/h1-3H,(H,11,12,13)
InChI key:NMCPFNYWLIXCSX-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C1)Cl)C(=O)NC(=N2)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.