CymitQuimica logo

CAS 1107695-02-2

:

2-Chloro-7-fluoro-4-quinazolinamine

Description:
2-Chloro-7-fluoro-4-quinazolinamine is a chemical compound characterized by its quinazoline core structure, which is a bicyclic aromatic compound containing two nitrogen atoms in the ring. This substance features a chlorine atom at the second position and a fluorine atom at the seventh position of the quinazoline ring, along with an amino group at the fourth position. These substituents contribute to its unique chemical properties, including potential reactivity and biological activity. The presence of halogens (chlorine and fluorine) often enhances lipophilicity and can influence the compound's pharmacokinetics and pharmacodynamics. 2-Chloro-7-fluoro-4-quinazolinamine may exhibit various biological activities, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific diseases. Its molecular structure suggests potential applications in areas such as cancer research or as a scaffold for drug design. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C8H5ClFN3
InChI:InChI=1S/C8H5ClFN3/c9-8-12-6-3-4(10)1-2-5(6)7(11)13-8/h1-3H,(H2,11,12,13)
InChI key:InChIKey=FZZMTSNZRBFGGU-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=C(Cl)N1)C=C(F)C=C2
Synonyms:
  • 2-Chloro-7-fluoro-4-quinazolinamine
  • 4-Quinazolinamine, 2-chloro-7-fluoro-
Found 1 products.