CymitQuimica logo

CAS 110772-46-8

:

D-2-Furylalanine

Description:
D-2-Furylalanine, with the CAS number 110772-46-8, is an amino acid derivative characterized by the presence of a furyl group attached to the alpha carbon of the alanine structure. This compound is a chiral molecule, existing in two enantiomeric forms, with the D-form being of particular interest in various biochemical applications. D-2-Furylalanine is known for its potential role in studies related to protein synthesis and enzyme activity, as it can be incorporated into peptides and proteins, influencing their structure and function. The furyl group contributes to its unique chemical properties, including its ability to participate in various chemical reactions, such as electrophilic substitutions. Additionally, D-2-Furylalanine may exhibit interesting biological activities, making it a subject of research in medicinal chemistry and pharmacology. Its solubility in water and organic solvents can vary, which is important for its application in different experimental conditions. Overall, D-2-Furylalanine serves as a valuable compound in both synthetic and biological chemistry contexts.
Formula:C7H9NO3
InChI:InChI=1/C7H9NO3/c8-6(7(9)10)4-5-2-1-3-11-5/h1-3,6H,4,8H2,(H,9,10)/t6-/m1/s1
InChI key:RXZQHZDTHUUJQJ-ZCFIWIBFSA-N
SMILES:c1cc(C[C@H](C(=O)O)N)oc1
Synonyms:
  • D-3-(2-Furyl)-Alanine
  • 3-furan-2-yl-L-alanine
  • (2R)-2-ammonio-3-furan-2-ylpropanoate
  • 3-(2-Furyl)-D-alanine
Found 3 products.