CymitQuimica logo

CAS 110843-90-8

:

2,3-Morpholinedione, 4-(phenylmethyl)-

Description:
2,3-Morpholinedione, 4-(phenylmethyl)-, also known by its CAS number 110843-90-8, is a chemical compound characterized by its morpholine ring structure, which is a six-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound features two carbonyl groups (diones) at the 2 and 3 positions of the morpholine ring, contributing to its reactivity and potential applications in organic synthesis. The presence of a phenylmethyl group at the 4-position enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature exhibit properties such as moderate solubility in organic solvents and potential interactions with biological systems, making them of interest in medicinal chemistry and drug development. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, 2,3-Morpholinedione, 4-(phenylmethyl)- represents a versatile scaffold for further chemical modifications and applications in various fields.
Formula:C11H11NO3
InChI:InChI=1S/C11H11NO3/c13-10-11(14)15-7-6-12(10)8-9-4-2-1-3-5-9/h1-5H,6-8H2
InChI key:ZOYULESMFLWDHB-UHFFFAOYSA-N
SMILES:C1COC(=O)C(=O)N1CC2=CC=CC=C2
Found 2 products.