CymitQuimica logo

CAS 110847-02-4

:

(1R,3S)-2,2-DIMETHYL-3-(2-OXOPROPYL)-CYCLOPROPANEACETONITRILE

Description:
(1R,3S)-2,2-Dimethyl-3-(2-oxopropyl)-cyclopropaneacetonitrile, with the CAS number 110847-02-4, is a chemical compound characterized by its unique cyclopropane structure, which includes a nitrile functional group and a ketone moiety. The presence of two methyl groups at the 2-position and a propanoyl group at the 3-position contributes to its steric and electronic properties, influencing its reactivity and potential applications in organic synthesis. This compound is typically used in research settings, particularly in the development of pharmaceuticals or agrochemicals, due to its structural complexity and potential biological activity. Its stereochemistry, indicated by the (1R,3S) configuration, suggests specific spatial arrangements that can affect its interactions with biological targets. As with many nitriles, it may exhibit toxicity and should be handled with appropriate safety precautions. Overall, this compound represents a valuable building block in synthetic chemistry, with implications for various fields including medicinal chemistry and materials science.
Formula:C10H15NO
InChI:InChI=1/C10H15NO/c1-7(12)6-9-8(4-5-11)10(9,2)3/h8-9H,4,6H2,1-3H3/t8-,9+/m1/s1
InChI key:KRZTYSCUOUIFHR-BDAKNGLRSA-N
SMILES:CC(=O)C[C@H]1[C@H](C1(C)C)CC#N
Synonyms:
  • (1R,3S)-2,2-Dimethyl-3-(2-Oxopropyl)-Cyclopropaneacetonitrile 99%
  • [(1R,3S)-2,2-dimethyl-3-(2-oxopropyl)cyclopropyl]acetonitrile
Found 1 products.