CymitQuimica logo

CAS 1108712-56-6

:

5-chlorothiophene-3-carbonitrile

Description:
5-Chlorothiophene-3-carbonitrile is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a chlorine atom at the 5-position and a cyano group (-C≡N) at the 3-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. It is known for its potential applications in pharmaceuticals and agrochemicals due to the reactivity of the cyano group, which can participate in various chemical reactions, including nucleophilic additions and substitutions. The chlorine substituent can also influence the compound's reactivity and stability, making it a valuable intermediate in synthetic chemistry. Additionally, the presence of the thiophene moiety can impart interesting electronic properties, which may be exploited in materials science and organic electronics. Overall, 5-chlorothiophene-3-carbonitrile is a versatile compound with significant implications in various fields of research and industry.
Formula:C5H2ClNS
InChI:InChI=1S/C5H2ClNS/c6-5-1-4(2-7)3-8-5/h1,3H
InChI key:BBGRLEJFPILYFH-UHFFFAOYSA-N
SMILES:C1=C(SC=C1C#N)Cl
Found 4 products.