CAS 1108743-60-7: Entrectinib
Description:Entrectinib is a small molecule inhibitor primarily used in the treatment of certain types of cancer, particularly those with neurotrophic tyrosine receptor kinase (NTRK) gene fusions and rearrangements in the ROS1 and ALK genes. It functions by selectively inhibiting the activity of these tyrosine kinases, which play a crucial role in cell signaling pathways that promote tumor growth and survival. The compound is characterized by its ability to penetrate the blood-brain barrier, making it effective for treating central nervous system metastases. Entrectinib is typically administered orally and has a favorable pharmacokinetic profile, including a relatively long half-life, which allows for once-daily dosing. Its efficacy has been demonstrated in clinical trials, leading to its approval for use in specific patient populations. As with many targeted therapies, potential side effects may include fatigue, dizziness, and gastrointestinal disturbances, necessitating careful monitoring during treatment. Overall, Entrectinib represents a significant advancement in precision oncology, offering hope for patients with specific genetic alterations in their tumors.
Formula:C31H34F2N6O2
InChI:InChI=1S/C31H34F2N6O2/c1-38-8-10-39(11-9-38)25-3-4-26(29(19-25)34-24-6-12-41-13-7-24)31(40)35-30-27-17-20(2-5-28(27)36-37-30)14-21-15-22(32)18-23(33)16-21/h2-5,15-19,24,34H,6-14H2,1H3,(H2,35,36,37,40)
InChI key:InChIKey=HAYYBYPASCDWEQ-UHFFFAOYSA-N
SMILES:O=C(NC1=NNC=2C=CC(=CC12)CC=3C=C(F)C=C(F)C3)C4=CC=C(C=C4NC5CCOCC5)N6CCN(C)CC6