CymitQuimica logo

CAS 110882-60-5

:

3-FLUORO-5-NITROBENZONITRILE

Description:
3-Fluoro-5-nitrobenzonitrile is an organic compound characterized by the presence of a fluorine atom, a nitro group, and a nitrile functional group attached to a benzene ring. Its molecular structure features a benzene ring substituted at the 3-position with a fluorine atom and at the 5-position with a nitro group, along with a cyano group (-C≡N) at the 1-position. This compound is typically a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its reactivity and ability to participate in various chemical reactions. The presence of both electron-withdrawing groups (the nitro and cyano groups) and an electron-donating group (the fluorine atom) influences its chemical behavior, making it a valuable intermediate in synthetic organic chemistry. Additionally, its properties, such as solubility and stability, can vary depending on the solvent and environmental conditions. Safety precautions should be observed when handling this compound, as it may pose health risks.
Formula:C7H3FN2O2
InChI:InChI=1/C7H3FN2O2/c8-6-1-5(4-9)2-7(3-6)10(11)12/h1-3H
InChI key:GPVDTRGEVKDJOI-UHFFFAOYSA-N
SMILES:c1c(cc(cc1F)N(=O)=O)C#N
Found 4 products.