CAS 110882-80-9
:2-[(4-Ethylphenyl)-phenylacetyl]-indan-1,3-dione
Description:
2-[(4-Ethylphenyl)-phenylacetyl]-indan-1,3-dione, with the CAS number 110882-80-9, is an organic compound characterized by its complex structure, which includes an indan-1,3-dione core substituted with a phenylacetyl group and an ethylphenyl moiety. This compound typically exhibits a yellow to orange color, indicative of its conjugated system, which can absorb visible light. It is likely to be soluble in organic solvents such as ethanol, acetone, and dichloromethane, while being less soluble in water due to its hydrophobic nature. The presence of multiple aromatic rings contributes to its stability and potential for π-π stacking interactions. Additionally, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its reactivity can be influenced by the functional groups present, allowing for potential modifications that could enhance its properties or efficacy in various applications. Overall, 2-[(4-Ethylphenyl)-phenylacetyl]-indan-1,3-dione represents a versatile structure in organic synthesis and pharmaceutical research.
Formula:C25H20O3
InChI:InChI=1S/C25H20O3/c1-2-16-12-14-18(15-13-16)21(17-8-4-3-5-9-17)25(28)22-23(26)19-10-6-7-11-20(19)24(22)27/h3-15,21-22H,2H2,1H3
InChI key:SGHMQVUTLMJUFJ-UHFFFAOYSA-N
SMILES:CCC1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)C3C(=O)C4=CC=CC=C4C3=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
