CymitQuimica logo

CAS 110931-72-1

:

1-biphenyl-4-yl-N-methylmethanamine

Description:
1-Biphenyl-4-yl-N-methylmethanamine, also known by its CAS number 110931-72-1, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a methyl group attached to a nitrogen atom, which is further connected to a methanamine group. The presence of the biphenyl moiety contributes to its potential applications in organic synthesis and materials science due to its unique electronic properties. The nitrogen atom in the amine group can participate in hydrogen bonding, influencing the compound's solubility and reactivity. Typically, compounds of this nature may exhibit moderate to high lipophilicity, making them relevant in medicinal chemistry for drug design. Additionally, the presence of both aromatic and aliphatic components can affect the compound's stability and interaction with biological systems. Safety and handling precautions should be observed, as with many organic amines, due to potential irritant properties. Overall, 1-biphenyl-4-yl-N-methylmethanamine represents a versatile structure in the realm of organic chemistry.
Formula:C14H15N
InChI:InChI=1/C14H15N/c1-15-11-12-7-9-14(10-8-12)13-5-3-2-4-6-13/h2-10,15H,11H2,1H3
InChI key:GZUHCAWQWUONPS-UHFFFAOYSA-N
SMILES:CNCc1ccc(cc1)c1ccccc1
Synonyms:
  • [1,1'-biphenyl]-4-methanamine, N-methyl-
  • N-Methyl-4-phenylbenzylamine
Found 4 products.