CymitQuimica logo

CAS 110931-86-7

:

5-Fluoro-1-naphthaldehyde

Description:
5-Fluoro-1-naphthaldehyde is an organic compound characterized by the presence of a naphthalene ring substituted with a fluorine atom and an aldehyde functional group. Its molecular structure features a fluorine atom at the 5-position of the naphthalene ring, which influences its reactivity and physical properties. This compound typically appears as a pale yellow to light brown solid and is known for its aromatic characteristics, contributing to its stability and potential applications in organic synthesis. The aldehyde group makes it a versatile intermediate in the synthesis of various chemical compounds, including pharmaceuticals and agrochemicals. 5-Fluoro-1-naphthaldehyde is also notable for its potential use in fluorescence studies and as a building block in the development of fluorescent probes. Its reactivity can be attributed to the electrophilic nature of the aldehyde group, allowing it to participate in various chemical reactions, such as condensation and substitution reactions. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C11H7FO
InChI:InChI=1S/C11H7FO/c12-11-6-2-4-9-8(7-13)3-1-5-10(9)11/h1-7H
InChI key:JJFWJEXWKQDOJL-UHFFFAOYSA-N
SMILES:C1=CC(=C2C=CC=C(C2=C1)F)C=O
Synonyms:
  • 5-Fluoro-1-naphthaldehyde 98%
  • 5-Fluoro-1-naphthaldehyde98%
Found 4 products.