CymitQuimica logo

CAS 110945-00-1

:

Ethanone, 2-chloro-1-[4-(dimethylamino)phenyl]- (9CI)

Description:
Ethanone, 2-chloro-1-[4-(dimethylamino)phenyl]- (commonly referred to as a derivative of acetophenone) is an organic compound characterized by its aromatic structure and the presence of both a chloro and a dimethylamino group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It is known for its potential applications in organic synthesis, particularly in the development of dyes and pharmaceuticals due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and electrophilic aromatic substitutions. The presence of the dimethylamino group enhances its electron-donating properties, making it a useful intermediate in the synthesis of more complex molecules. Additionally, the chloro substituent can influence the reactivity and solubility of the compound in different solvents. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure. Proper storage and handling protocols are essential to ensure safety in laboratory settings.
Formula:C10H12ClNO
InChI:InChI=1/C10H12ClNO/c1-12(2)9-5-3-8(4-6-9)10(13)7-11/h3-6H,7H2,1-2H3
InChI key:ONHGPIBFTKDBHT-UHFFFAOYSA-N
SMILES:CN(C)c1ccc(cc1)C(=O)CCl
Synonyms:
  • 2-Chloro-4'-(Dimethylamino)Acetophenone
  • 2-Chloro-1-[4-(Dimethylamino)Phenyl]Ethanone
Found 2 products.