CAS 111010-08-3

1-Bromo-2-chloro-4-fluoro-5-nitrobenzene

Description:

1-Bromo-2-chloro-4-fluoro-5-nitrobenzene is an aromatic halogenated compound characterized by the presence of multiple substituents on a benzene ring. This compound features a bromine atom, a chlorine atom, a fluorine atom, and a nitro group, which significantly influence its chemical properties and reactivity. The presence of these electronegative halogens and the nitro group contributes to the compound's overall polarity and can affect its solubility in various solvents. Typically, such compounds exhibit moderate to high stability under standard conditions but may undergo electrophilic substitution reactions due to the electron-withdrawing nature of the nitro group. Additionally, the presence of multiple halogens can enhance the compound's utility in organic synthesis and materials science. Safety considerations are important, as halogenated compounds can be toxic and environmentally persistent. Overall, 1-Bromo-2-chloro-4-fluoro-5-nitrobenzene is a valuable compound in research and industrial applications, particularly in the synthesis of pharmaceuticals and agrochemicals.

Formula: C6H2BrClFNO2

InChI: InChI=1S/C6H2BrClFNO2/c7-3-1-6(10(11)12)5(9)2-4(3)8/h1-2H

InChI key: YVDJBLFLBBBGMD-UHFFFAOYSA-N

SMILES: C1=C(C(=CC(=C1Br)Cl)F)[N+](=O)[O-]

1-Bromo-2-chloro-4-fluoro-5-nitrobenzene

CAS: 111010-08-3

1-Bromo-2-chloro-4-fluoro-5-nitrobenzene

Formula: C₆H₂BrClFNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 254.44098

Ref: 54-PC902596

Benzene, 1-bromo-2-chloro-4-fluoro-5-nitro-

CAS: 111010-08-3

Formula: C₆H₂BrClFNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 254.4410

Ref: IN-DA007BP5

1-BROMO-2-CHLORO-4-FLUORO-5-NITROBENZENE

CAS: 111010-08-3

Formula: C₆H₂BrClFNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 254.44

Ref: 10-F535797

1-Bromo-2-chloro-4-fluoro-5-nitrobenzene

CAS: 111010-08-3

1-Bromo-2-chloro-4-fluoro-5-nitrobenzene

Formula: C₆H₂BrClFNO₂

Purity: 98%

Molecular weight: 254.44

Ref: IN-DG364585

1-bromo-2-chloro-4-fluoro-5-nitrobenzene

CAS: 111010-08-3

1-Bromo-2-chloro-4-fluoro-5-nitrobenzene is an herbicidal agent that inhibits the growth of plants by interfering with photosynthesis. It has been shown to inhibit the activity of phenylalanine ammonia lyase in plants, which is an enzyme involved in the production of phenylpropanoids. This interference leads to a decrease in the production of plant hormones such as auxins and gibberellins, which are responsible for cell elongation and seed development. 1-Bromo-2-chloro-4-fluoro-5 nitrobenzene also inhibits sulfuric acid and sulfuric acid esterases that are responsible for the metabolism of these acids, respectively. This inhibition causes a buildup of these substances in plants, leading to their death.

Formula: C₆H₂BrClFNO₂

Purity: Min. 95%

Molecular weight: 254.44 g/mol

Ref: 3D-LEA01008