CymitQuimica logo

CAS 1111096-07-1

:

1,3,2-Dioxaborolane, 2-(5-bromo-2-fluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-

Description:
1,3,2-Dioxaborolane, 2-(5-bromo-2-fluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl- is a boron-containing heterocyclic compound characterized by its dioxaborolane ring structure, which features a five-membered ring containing two oxygen atoms and one boron atom. This compound is notable for its incorporation of a substituted phenyl group, specifically one that includes a bromine and a fluorine atom, as well as a methoxy group, which can influence its reactivity and solubility. The presence of tetramethyl groups enhances its steric bulk, potentially affecting its interactions in chemical reactions. Generally, dioxaborolanes are known for their utility in organic synthesis, particularly in the formation of boron-containing intermediates and as reagents in cross-coupling reactions. The specific substituents in this compound may impart unique electronic properties, making it of interest in medicinal chemistry and materials science. Its stability, solubility, and reactivity can vary based on the substituents and the overall molecular structure.
Formula:C13H17BBrFO3
InChI:InChI=1S/C13H17BBrFO3/c1-12(2)13(3,4)19-14(18-12)8-6-9(15)11(17-5)7-10(8)16/h6-7H,1-5H3
InChI key:JPDCPQSPPPULST-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)OC)Br
Synonyms:
  • 1,3,2-Dioxaborolane, 2-(5-bromo-2-fluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-
Found 2 products.