CymitQuimica logo

CAS 1111111-04-6

:

6-(4-Fluorophenyl)-2(1H)-pyridinone

Description:
6-(4-Fluorophenyl)-2(1H)-pyridinone is an organic compound characterized by its pyridinone structure, which features a pyridine ring fused with a carbonyl group and a phenyl substituent. The presence of the 4-fluorophenyl group indicates that there is a fluorine atom attached to the para position of the phenyl ring, influencing the compound's electronic properties and potentially its reactivity. This compound may exhibit properties typical of both aromatic and heterocyclic compounds, such as stability and the ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the pyridinone and fluorophenyl moieties, which can enhance biological activity. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of functional groups. However, detailed experimental data would be necessary to fully characterize its behavior in various environments.
Formula:C11H8FNO
InChI:InChI=1S/C11H8FNO/c12-9-6-4-8(5-7-9)10-2-1-3-11(14)13-10/h1-7H,(H,13,14)
InChI key:InChIKey=ZDTZYSZHJGUSLG-UHFFFAOYSA-N
SMILES:O=C1NC(=CC=C1)C2=CC=C(F)C=C2
Synonyms:
  • 6-(4-Fluorophenyl)-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 6-(4-fluorophenyl)-
Found 2 products.