CAS 111196-17-9

H-BETA-ALA-PNA HBR

Description:

H-BETA-ALA-PNA HBr, with the CAS number 111196-17-9, is a chemical compound that serves as a peptide derivative. It is characterized by the presence of a beta-alanine moiety, which is an amino acid known for its role in various biological processes. The compound is typically utilized in biochemical research and applications, particularly in the synthesis of peptide-based probes or in studies involving peptide interactions. The HBr indicates that the compound is in the hydrobromide salt form, which can enhance its solubility in aqueous solutions. This characteristic is particularly useful in laboratory settings where solubility is crucial for experimental procedures. Additionally, the compound may exhibit specific biological activities, making it of interest in pharmacological studies. As with many peptide derivatives, it is important to handle H-BETA-ALA-PNA HBr with care, following appropriate safety protocols, as it may have specific reactivity or toxicity profiles depending on the context of its use.

Formula: C₉H₁₂BrN₃O₃

InChI: InChI=1S/C9H11N3O3.BrH/c10-6-5-9(13)11-7-1-3-8(4-2-7)12(14)15;/h1-4H,5-6,10H2,(H,11,13);1H

InChI key: WDFTXMCEXYTXHF-UHFFFAOYSA-N

SMILES: C1=CC(=CC=C1NC(=O)CCN)[N+](=O)[O-].Br

Synonyms:

• H-b-Ala-pNA.HBr

3-Amino-N-(4-nitrophenyl)propanamide hydrobromide

CAS: 111196-17-9

3-Amino-N-(4-nitrophenyl)propanamide hydrobromide

Formula: C₉H₁₂BrN₃O₃

Purity: 95%

Molecular weight: 290.12

Ref: 54-OR1045508

H-β-ALA-PNA HBR

CAS: 111196-17-9

Formula: C₉H₁₂BrN₃O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 290.1139

Ref: IN-DA00917F

H-beta-Ala-pNA·HBr

CAS: 111196-17-9

H-beta-Ala-pNA·HBr is a nonlinear material that displays discontinuity, heterogeneity and anisotropy. It is subject to analyses of uniaxial and linear elasticity. The tensile properties of H-beta-Ala-pNA·HBr are linear and the material displays a nonlinear behavior in extension. H-beta-Ala-pNA·HBr has been used for applications such as tissue engineering due to its high surface area, which increases the probability of cell adhesion.

Formula: C₉H₁₁N₃O₃·HBr

Purity: Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 290.11 g/mol

Ref: 3D-FA49957

3-Amino-N-(4-nitrophenyl)propanamide hydrobromide

CAS: 111196-17-9

3-Amino-N-(4-nitrophenyl)propanamide hydrobromide

Formula: C₉H₁₂BrN₃O₃

Purity: 95%

Molecular weight: 290.11

Ref: IN-DG316400

β-Ala-pNA·HBr

CAS: 111196-17-9

Formula: C₉H₁₂BrN₃O₃

Purity: 99.0%

Molecular weight: 290.117

Ref: 10-F493373

H-β-Ala-pNA HBr

Controlled Product

CAS: 111196-17-9

Formula: C₉H₁₁N₃O₃·HBr

Color and Shape: Neat

Molecular weight: 290.114

Ref: TR-A614143