CymitQuimica logo

CAS 11141-16-5

:

Aroclor 1232

Description:
Aroclor 1232 is a commercial mixture of polychlorinated biphenyls (PCBs) that was produced by Monsanto. It is characterized by its relatively low chlorine content, typically containing about 32% chlorine by weight. Aroclor 1232 is known for its chemical stability, hydrophobicity, and resistance to degradation, which contribute to its persistence in the environment. This substance is a colorless to light yellow liquid with a high boiling point and low vapor pressure, making it suitable for use as a dielectric fluid in electrical equipment and as a heat transfer medium. However, due to its toxicological properties, including potential carcinogenic effects and bioaccumulation in the food chain, Aroclor 1232 has been largely phased out and is subject to strict regulatory controls. Its environmental persistence and potential health risks have led to significant concern, prompting ongoing research into its effects and remediation strategies. Proper handling and disposal are critical to mitigate its impact on human health and the environment.
Formula:Unspecified
InChI:InChI=1S/C12H9Cl/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H
InChI key:LAXBNTIAOJWAOP-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CC=CC=C2Cl
Synonyms:
  • Aroclor 1232
Found 9 products.