CAS 1114491-60-9

Formula: C15H22O2

InChI: InChI=1S/C15H22O2/c1-8-5-6-10(16)9-7-11(17)12-13(14(12,2)3)15(8,9)4/h7-8,10,12-13,16H,5-6H2,1-4H3/t8-,10+,12-,13+,15+/m0/s1

InChI key: KDPNSOLPHGZUAY-RHVNPFLSSA-N

SMILES: C[C@H]1CC[C@H](C2=CC(=O)[C@H]3[C@@H]([C@]12C)C3(C)C)O

Axinysone B

CAS: 1114491-60-9

Axinysone B

Formula: C₁₅H₂₂O₂

Purity: ≥98%

Molecular weight: 234.33

Ref: 54-OR1112477

Axinysone B

CAS: 1114491-60-9

Purity: 98%

Ref: IN-DA01V2XG

Axinysone B

CAS: 1114491-60-9

Formula: C₁₅H₂₂O₂

Purity: 95%~99%

Molecular weight: 234.339

Ref: BP-BP5719

Axinysone B

CAS: 1114491-60-9

Please enquire for more information about Axinysone B including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₅H₂₂O₂

Purity: Min. 95%

Molecular weight: 234.33 g/mol

Ref: 3D-PUB49160