CymitQuimica logo

CAS 1115639-92-3

:

(3-(Triphenylen-2-yl)phenyl)boronic acid pinacol ester

Description:
(3-(Triphenylen-2-yl)phenyl)boronic acid pinacol ester is an organoboron compound characterized by the presence of a boronic acid functional group esterified with pinacol, alongside a triphenylene moiety. This compound typically exhibits properties associated with boron-containing compounds, such as the ability to form reversible covalent bonds with diols, making it useful in various applications including organic synthesis and materials science. The triphenylene structure contributes to its potential as a luminescent material, as it can exhibit strong π-π stacking interactions and fluorescence. Additionally, the presence of the boronic acid functionality allows for potential applications in medicinal chemistry, particularly in drug design and development, due to its ability to interact with biological targets. The compound's solubility, stability, and reactivity can vary based on the specific substituents and the overall molecular architecture, making it a subject of interest in both academic and industrial research. Overall, this compound exemplifies the versatility of organoboron chemistry in functional material development.
Formula:C30H27BO2
InChI:InChI=1S/C30H27BO2/c1-29(2)30(3,4)33-31(32-29)22-11-9-10-20(18-22)21-16-17-27-25-14-6-5-12-23(25)24-13-7-8-15-26(24)28(27)19-21/h5-19H,1-4H3
InChI key:NZTBACVVLACPNL-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3=CC4=C(C=C3)C5=CC=CC=C5C6=CC=CC=C64
Synonyms:
  • 4,4,5,5-Tetramethyl-2-(3-(Triphenylen-2-Yl)Phenyl)-1,3,2-Dioxaborolane
Found 5 products.