CAS 111704-98-4
:2-Pyrrolidineacetic acid, methyl ester
Description:
2-Pyrrolidineacetic acid, methyl ester, with the CAS number 111704-98-4, is an organic compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features an acetic acid moiety esterified with a methyl group, contributing to its solubility in organic solvents. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of both the pyrrolidine and acetic acid functionalities suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of such compounds to interact with biological systems. Its molecular structure allows for various chemical reactions, including esterification and amine reactivity, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological properties. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-10-7(9)5-6-3-2-4-8-6/h6,8H,2-5H2,1H3
InChI key:QVQOWGPBRKRAOW-UHFFFAOYSA-N
SMILES:COC(=O)CC1CCCN1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
