CAS 111750-67-5
:1,2,5-Metheno-1H,5H-imidazo[2,1-i]indole-7,10-dione,8-amino-6-[[(aminocarbonyl)oxy]methyl]-2,3,6,6a-tetrahydro-5-methoxy-9-methyl-,(1S,2S,4S,5R,6S,6aR,10aS,11S)- (9CI)
Description:
1,2,5-Metheno-1H,5H-imidazo[2,1-i]indole-7,10-dione, 8-amino-6-[[(aminocarbonyl)oxy]methyl]-2,3,6,6a-tetrahydro-5-methoxy-9-methyl-, (1S,2S,4S,5R,6S,6aR,10aS,11S)- (9CI), with CAS number 111750-67-5, is a complex organic compound characterized by its unique bicyclic structure that incorporates both imidazole and indole moieties. This compound features multiple functional groups, including amino, methoxy, and carbonyl groups, which contribute to its potential biological activity. The stereochemistry indicated by the (1S,2S,4S,5R,6S,6aR,10aS,11S) designation suggests that it has specific spatial arrangements that may influence its interactions with biological targets. It is likely to exhibit solubility in polar solvents due to the presence of hydrophilic groups, while its aromatic components may contribute to hydrophobic interactions. The compound's structural complexity and functional diversity suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C15H18N4O5
InChI:InChI=1S/C15H18N4O5/c1-5-9(16)10(20)8-6(4-24-13(17)22)15(23-2)11-7-3-18(15)14(8,12(5)21)19(7)11/h6-8,11H,3-4,16H2,1-2H3,(H2,17,22)/t6-,7+,8+,11+,14-,15-,19?/m1/s1
InChI key:ZOVLGAUVYBEUSN-UFXSHCHASA-N
SMILES:CC1=C(C(=O)[C@@H]2[C@H]([C@]3([C@@H]4[C@H]5N4[C@]2(C1=O)N3C5)OC)COC(=O)N)N
Synonyms:- 1,2,5-Metheno-1H,5H-imidazo[2,1-i]indole-7,10-dione,8-amino-6-[[(aminocarbonyl)oxy]methyl]-2,3,6,6a-tetrahydro-5-methoxy-9-methyl-,[1S-(1a,2a,4b,5b,6a,6aa,10aR*,11R*)]-
- Albomitomycin C
- Antibiotic CX 1
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ref: 4Z-M-842
Discontinued product

