CAS 111768-16-2

Formula: C21H23N3O2

InChI: InChI=1S/C21H23N3O2/c1-12(2)10-17-19-14(13-6-3-4-7-15(13)22-19)11-18-20(25)23-9-5-8-16(23)21(26)24(17)18/h3-4,6-7,10,16-18,22H,5,8-9,11H2,1-2H3/t16-,17-,18-/m0/s1

InChI key: LQXCSIKDOISJTI-BZSNNMDCSA-N

SMILES: CC(=C[C@H]1C2=C(C[C@@H]3N1C(=O)[C@@H]4CCCN4C3=O)C5=CC=CC=C5N2)C

Demethoxyfumitremorgin C

CAS: 111768-16-2

Formula: C₂₁H₂₃N₃O₂

Molecular weight: 349.4262

Ref: IN-DA009N91

Demethoxyfumitremorgin C

CAS: 111768-16-2

Demethoxyfumitremorgin C inhibits PC3 prostate cancer cell growth and promotes apoptosis at G2/M phase.

Formula: C₂₁H₂₃N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 349.434

Ref: TM-TN6059

Demethoxyfumitremorgin C

CAS: 111768-16-2

Demethoxyfumitremorgin C is a mycotoxin, which is a naturally occurring compound produced by fungi. Specifically, it is derived from species of the Aspergillus genus. This compound functions by inhibiting ATP-binding cassette (ABC) transporters, particularly the breast cancer resistance protein (BCRP/ABCG2). ABC transporters are essential membrane proteins involved in the active transport of a wide range of substrates across cellular membranes, and their regulation plays a crucial role in multidrug resistance mechanisms in cells.

Formula: C₂₁H₂₃N₃O₂

Purity: Min. 95%

Molecular weight: 349.4 g/mol

Ref: 3D-LEA76816