CAS 111795-43-8
:(R)-(+)-3,3-Dibromo-1,1-bi-2-naphtol
Description:
(R)-(+)-3,3-Dibromo-1,1-bi-2-naphtol is a chiral organic compound characterized by its unique structure, which features two naphthalene rings connected by a central carbon atom that bears two bromine substituents and hydroxyl groups. This compound is notable for its potential applications in asymmetric synthesis and as a chiral auxiliary in various chemical reactions. The presence of bromine atoms enhances its reactivity, making it useful in further chemical transformations. The hydroxyl groups contribute to its solubility in polar solvents and can participate in hydrogen bonding, influencing its physical properties. As a chiral molecule, it exhibits optical activity, which is significant in the field of pharmaceuticals, where enantiomeric purity can affect biological activity. The compound's stability and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, (R)-(+)-3,3-Dibromo-1,1-bi-2-naphtol is an important compound in organic chemistry, particularly in the development of chiral drugs and materials.
Formula:C20H12Br2O2
InChI:InChI=1/C20H12Br2O2/c21-15-9-11-5-1-3-7-13(11)17(19(15)23)18-14-8-4-2-6-12(14)10-16(22)20(18)24/h1-10,23-24H
SMILES:c1ccc2c(c1)cc(c(c2c1c2ccccc2cc(c1O)Br)O)Br
Synonyms:- (R)-3,3-Dibromo-1,1-bi-2-naphthol
- 3,3'-Dibromo-1,1'-Binaphthalene-2,2'-Diol
- (R)-3,3'-Dibromo-2,2'-Dihydroxy-1,1'-Binaphthyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(R)-3,3'-Dibromo-1,1'-bi-2-naphthol
CAS:Formula:C20H12Br2O2Purity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:444.12(R)-(+)-3,3'-Dibromo-1,1'-bi-2-naphthol, min. 98%
CAS:(R)-(+)-3,3'-Dibromo-1,1'-bi-2-naphthol, min. 98%
Formula:C20H12Br2O2Purity:min. 98%Color and Shape:white pwdr.Molecular weight:444.13(R)-3,3'-Dibromo-1,1'-Bi-2-Naphthol
CAS:(R)-3,3'-Dibromo-1,1'-Bi-2-NaphtholFormula:C20H12Br2O2Purity:98%,99%eeColor and Shape:SolidMolecular weight:444.12[1,1'-Binaphthalene]-2,2'-diol, 3,3'-dibromo-, (1R)-
CAS:Formula:C20H12Br2O2Purity:95%Color and Shape:SolidMolecular weight:444.1161(R)-3,3'-Dibromo-1,1'-bi-2-naphthol
CAS:(R)-3,3'-Dibromo-1,1'-bi-2-naphthol is an aromatic hydrocarbon that is chiral. It has been used as a reagent in organic synthesis and as a fluorescent labeling agent for HPLC analysis. (R)-3,3'-Dibromo-1,1'-bi-2-naphthol has also been used to synthesize biphenyls. (R)-3,3'-Dibromo-1,1'-bi-2-naphthol can be found in natural products such as flavanones and styrene. It can act as a solvating or additive agent in organic reactions and reactions involving aromatics.
Formula:C20H12Br2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:444.12 g/molRef: 10-F569787
Discontinued product





