CAS 111878-21-8
:4-Pyrimidinamine, 5-fluoro-N-(trimethylsilyl)-2-[(trimethylsilyl)oxy]-
Description:
4-Pyrimidinamine, 5-fluoro-N-(trimethylsilyl)-2-[(trimethylsilyl)oxy]- is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing nitrogen atoms. The presence of a fluorine atom at the 5-position of the pyrimidine ring contributes to its unique reactivity and potential applications in medicinal chemistry. The trimethylsilyl groups attached to the nitrogen and oxygen atoms enhance the compound's stability and solubility, making it useful in various synthetic processes. This compound may exhibit properties typical of pyrimidine derivatives, such as biological activity, and could be of interest in the development of pharmaceuticals or agrochemicals. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery. As with many silyl derivatives, it may also serve as a protecting group in organic synthesis, facilitating the manipulation of functional groups in complex molecules. Overall, this compound's unique features make it a subject of interest in both research and industrial applications.
Formula:C10H20FN3OSi2
InChI:InChI=1S/C10H20FN3OSi2/c1-16(2,3)14-9-8(11)7-12-10(13-9)15-17(4,5)6/h7H,1-6H3,(H,12,13,14)
InChI key:XYXXDROPCNNSOA-UHFFFAOYSA-N
SMILES:C[Si](C)(C)NC1=NC(=NC=C1F)O[Si](C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
