CymitQuimica logo

CAS 111992-61-1

:

1H-Isoindole-1,3(2H)-dione, 2-(3-bromo-2,2-dimethylpropyl)-

Description:
1H-Isoindole-1,3(2H)-dione, 2-(3-bromo-2,2-dimethylpropyl)-, identified by its CAS number 111992-61-1, is a chemical compound that features a bicyclic isoindole structure with a dione functional group. This compound is characterized by the presence of a brominated alkyl side chain, specifically a 3-bromo-2,2-dimethylpropyl group, which contributes to its unique reactivity and potential applications in organic synthesis. The isoindole core is known for its involvement in various biological activities, making derivatives of this compound of interest in medicinal chemistry. The presence of the bromine atom enhances the compound's electrophilicity, potentially facilitating nucleophilic substitution reactions. Additionally, the bulky dimethylpropyl group may influence the steric properties and solubility of the compound. Overall, this substance may exhibit interesting chemical behavior and biological properties, warranting further investigation for potential applications in pharmaceuticals or agrochemicals.
Formula:C13H14BrNO2
InChI:InChI=1S/C13H14BrNO2/c1-13(2,7-14)8-15-11(16)9-5-3-4-6-10(9)12(15)17/h3-6H,7-8H2,1-2H3
InChI key:LQAHBCLEIHEEPN-UHFFFAOYSA-N
SMILES:CC(C)(CN1C(=O)C2=CC=CC=C2C1=O)CBr
Found 3 products.