
CAS 1120214-78-9
:4-chloro-2-(methylsulfanyl)pyrrolo[2,1-f][1,2,4]triazine
Description:
4-Chloro-2-(methylsulfanyl)pyrrolo[2,1-f][1,2,4]triazine is a heterocyclic compound characterized by its complex ring structure, which incorporates both triazine and pyrrole moieties. The presence of a chlorine atom and a methylsulfanyl group contributes to its unique chemical properties, influencing its reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of agrochemicals or medicinal compounds. The chlorine substituent can enhance the compound's lipophilicity, while the methylsulfanyl group may participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 4-chloro-2-(methylsulfanyl)pyrrolo[2,1-f][1,2,4]triazine represents a class of compounds that may have significant implications in synthetic chemistry and drug discovery.
Formula:C7H6ClN3S
InChI:InChI=1S/C7H6ClN3S/c1-12-7-9-6(8)5-3-2-4-11(5)10-7/h2-4H,1H3
InChI key:LLXWRYLNACYLMU-UHFFFAOYSA-N
SMILES:CSC1=NN2C=CC=C2C(=N1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Chloro-2-(methylthio)pyrrolo[2,1-f][1,2,4]triazine
CAS:Formula:C7H6ClN3SColor and Shape:SolidMolecular weight:199.66064-Chloro-2-(methylthio)pyrrolo[1,2-f][1,2,4]triazine
CAS:4-Chloro-2-(methylthio)pyrrolo[1,2-f][1,2,4]triazine
Molecular weight:199.66064g/mol


