CymitQuimica logo

CAS 112197-14-5

:

2-Methoxy-3-pyridineethanol

Description:
2-Methoxy-3-pyridineethanol, with the CAS number 112197-14-5, is an organic compound characterized by its pyridine and alcohol functional groups. It features a methoxy group (-OCH3) attached to a pyridine ring, which contributes to its polar nature and potential for hydrogen bonding. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in water and organic solvents, making it versatile for various applications in organic synthesis and pharmaceuticals. The presence of the hydroxyl (-OH) group enhances its reactivity, allowing it to participate in various chemical reactions, such as etherification and esterification. Additionally, the methoxy group can influence the electronic properties of the molecule, affecting its reactivity and interaction with biological systems. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 2-Methoxy-3-pyridineethanol is a valuable compound in chemical research and development.
Formula:C8H11NO2
InChI:InChI=1S/C8H11NO2/c1-11-8-7(4-6-10)3-2-5-9-8/h2-3,5,10H,4,6H2,1H3
InChI key:InChIKey=RHBRKXDRHSBKSZ-UHFFFAOYSA-N
SMILES:C(CO)C1=C(OC)N=CC=C1
Synonyms:
  • 2-Methoxy-3-pyridineethanol
  • 2-(2-Methoxypyridin-3-yl)ethan-1-ol
  • 2-(2-Methoxypyridin-3-yl)ethanol
  • 3-Pyridineethanol, 2-methoxy-
Found 1 products.