CymitQuimica logo

CAS 1122-63-0

:

Ethanone, 1-(3-pyridazinyl)-

Description:
Ethanone, 1-(3-pyridazinyl)-, also known by its CAS number 1122-63-0, is an organic compound characterized by the presence of a pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a ketone functional group (ethanone) attached to the pyridazine moiety, contributing to its reactivity and potential applications in various chemical reactions. Typically, compounds like this exhibit moderate polarity due to the presence of the carbonyl group, which can engage in hydrogen bonding. The pyridazine ring can influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its structural features suggest potential uses in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, which can be exploited in materials science or coordination chemistry.
Formula:C6H6N2O
InChI:InChI=1/C6H6N2O/c1-5(9)6-3-2-4-7-8-6/h2-4H,1H3
InChI key:FTSKLNSVINAQGJ-UHFFFAOYSA-N
SMILES:CC(=O)c1cccnn1
Synonyms:
  • 1-(Pyridazin-3-Yl)Ethanone
  • 1-(Pyridazin-3-Yl)Ethan-1-One
Found 4 products.