CymitQuimica logo

CAS 1122-99-2

:

Cyclopentylacetyl chloride

Description:
Cyclopentylacetyl chloride, with the CAS number 1122-99-2, is an organic compound characterized by its functional groups, specifically the acyl chloride and cyclopentyl moiety. It features a cyclopentyl group attached to an acetyl chloride, making it a member of the acyl chloride family. This compound is typically a colorless to pale yellow liquid with a pungent odor, indicative of its reactivity. Cyclopentylacetyl chloride is known for its ability to undergo nucleophilic acyl substitution reactions, making it useful in organic synthesis, particularly in the formation of amides and esters. It is also sensitive to moisture and can hydrolyze to form the corresponding carboxylic acid and hydrochloric acid upon exposure to water. Due to its reactivity, it should be handled with care, using appropriate safety measures to avoid inhalation or skin contact. Overall, cyclopentylacetyl chloride serves as a valuable intermediate in the synthesis of various chemical compounds in the pharmaceutical and agrochemical industries.
Formula:C7H11ClO
InChI:InChI=1S/C7H11ClO/c8-7(9)5-6-3-1-2-4-6/h6H,1-5H2
InChI key:InChIKey=NILLIUYSJFTTRH-UHFFFAOYSA-N
SMILES:C(C(Cl)=O)C1CCCC1
Synonyms:
  • 2-Cyclopentylacetyl chloride
  • Cyclopentaneacetyl chloride
  • Cyclopentylacetyl chloride
Found 5 products.