CymitQuimica logo

CAS 1122090-95-2

:

pyridine, 2,5-dichloro-4-methoxy-

Description:
Pyridine, 2,5-dichloro-4-methoxy- is an organic compound characterized by a pyridine ring substituted with two chlorine atoms and a methoxy group. The presence of the pyridine ring, a six-membered aromatic heterocycle containing one nitrogen atom, imparts basic properties to the compound. The chlorine substituents at the 2 and 5 positions contribute to its reactivity and influence its electronic properties, while the methoxy group at the 4 position can affect solubility and polarity. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It may exhibit moderate to high toxicity, and appropriate safety measures should be taken when handling it. Additionally, its chemical structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. As with many halogenated compounds, it may also be subject to environmental regulations due to potential persistence and bioaccumulation.
Formula:C6H5Cl2NO
InChI:InChI=1S/C6H5Cl2NO/c1-10-5-2-6(8)9-3-4(5)7/h2-3H,1H3
InChI key:XHZSAGSNTXMQTE-UHFFFAOYSA-N
SMILES:COc1cc(Cl)ncc1Cl
Synonyms:
  • 2,5-Dichloro-4-methoxypyridine
Found 4 products.