CymitQuimica logo

CAS 112211-88-8

:

(S)-2-Isopropylamino-3-methyl-1-butanol

Description:
(S)-2-Isopropylamino-3-methyl-1-butanol, with the CAS number 112211-88-8, is an organic compound characterized by its chiral structure, which includes an isopropylamino group and a hydroxyl functional group. This compound is typically a colorless to pale yellow liquid and is soluble in water due to the presence of the hydroxyl group, which can form hydrogen bonds. Its molecular structure suggests it may exhibit basic properties due to the amino group, allowing it to participate in various chemical reactions, including nucleophilic substitutions. The presence of both an amino and an alcohol functional group indicates potential applications in pharmaceuticals, particularly in the synthesis of biologically active compounds. Additionally, the stereochemistry of the molecule can influence its biological activity and interaction with other substances, making it significant in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H19NO
InChI:InChI=1/C8H19NO/c1-6(2)8(5-10)9-7(3)4/h6-10H,5H2,1-4H3/t8-/m1/s1
InChI key:ANZBKMZVBJDTEL-MRVPVSSYSA-N
SMILES:CC(C)[C@@H](CO)NC(C)C
Synonyms:
  • (2S)-2-(Isopropylamino)-3-methylbutan-1-ol
  • 1-butanol, 3-methyl-2-[(1-methylethyl)amino]-, (2S)-
Found 4 products.