CymitQuimica logo

CAS 112230-06-5

:

(2-propoxyphenyl)methanol

Description:
(2-Propoxyphenyl)methanol, with the CAS number 112230-06-5, is an organic compound characterized by its structure, which features a phenolic ring substituted with a propoxy group and a hydroxymethyl group. This compound typically exhibits a moderate to high polarity due to the presence of the hydroxyl (-OH) group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The propoxy group contributes to its hydrophobic characteristics, affecting its overall solubility profile. (2-Propoxyphenyl)methanol may display moderate volatility and can participate in various chemical reactions, including oxidation and substitution reactions, due to the functional groups present. Its potential applications could span across pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are in place.
Formula:C10H14O2
InChI:InChI=1/C10H14O2/c1-2-7-12-10-6-4-3-5-9(10)8-11/h3-6,11H,2,7-8H2,1H3
InChI key:XUNHRWOLRPWIIC-UHFFFAOYSA-N
SMILES:CCCOc1ccccc1CO
Found 4 products.