CymitQuimica logo

CAS 112241-24-4

:

Benzoic acid, 4-(1-mercaptoethyl)-

Description:
Benzoic acid, 4-(1-mercaptoethyl)-, also known by its CAS number 112241-24-4, is an organic compound that features a benzoic acid moiety substituted with a mercaptoethyl group at the para position. This compound typically exhibits characteristics common to benzoic acids, such as being a white crystalline solid at room temperature. It is soluble in polar solvents like water and alcohols, while being less soluble in non-polar solvents. The presence of the mercaptoethyl group introduces thiol characteristics, which can impart unique reactivity, including the ability to form disulfide bonds and participate in redox reactions. This compound may also exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its functional groups allow for potential applications in various fields, including organic synthesis and materials science. As with many organic compounds, safety precautions should be observed when handling this substance due to potential toxicity and reactivity.
Formula:C9H10O2S
InChI:InChI=1S/C9H10O2S/c1-6(12)7-2-4-8(5-3-7)9(10)11/h2-6,12H,1H3,(H,10,11)
InChI key:JQXMPKSXDNZGQU-UHFFFAOYSA-N
SMILES:CC(C1=CC=C(C=C1)C(=O)O)S
Synonyms:
  • 4-(1-sulfanylethyl)benzoic acid
  • Benzoic acid, 4-(1-mercaptoethyl)-
Found 3 products.