CymitQuimica logo

CAS 112257-12-2

:

1-Piperazinecarboxylic acid, 4-(bromoacetyl)-, 1,1-dimethylethyl ester

Description:
1-Piperazinecarboxylic acid, 4-(bromoacetyl)-, 1,1-dimethylethyl ester, identified by CAS number 112257-12-2, is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound features a bromoacetyl group, which introduces a bromine atom and an acetyl moiety, enhancing its reactivity and potential applications in organic synthesis. The presence of the tert-butyl ester group contributes to its lipophilicity, potentially influencing its solubility and permeability in biological systems. The compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Its synthesis typically involves the reaction of piperazine derivatives with bromoacetyl compounds, followed by esterification. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks or environmental hazards. Overall, its unique structure suggests potential utility in various chemical and pharmaceutical applications.
Formula:C11H19BrN2O3
InChI:InChI=1S/C11H19BrN2O3/c1-11(2,3)17-10(16)14-6-4-13(5-7-14)9(15)8-12/h4-8H2,1-3H3
InChI key:LFJTTZCBJLCUIV-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCN(CC1)C(=O)CBr
Found 5 products.