CymitQuimica logo

CAS 112258-59-0

:

4-(Chloromethyl)-1-methyl-1H-imidazole

Description:
4-(Chloromethyl)-1-methyl-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a chloromethyl group (-CH2Cl) at the 4-position and a methyl group (-CH3) at the 1-position of the imidazole ring. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the chloromethyl group makes it a reactive compound, often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity can facilitate nucleophilic substitution reactions, making it valuable in various chemical transformations. Additionally, the imidazole moiety contributes to its potential biological activity, as imidazole derivatives are known for their roles in medicinal chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks due to its chlorinated nature and potential toxicity.
Formula:C5H7ClN2
InChI:InChI=1S/C5H7ClN2/c1-8-3-5(2-6)7-4-8/h3-4H,2H2,1H3
InChI key:InChIKey=QVAQFEBMXMVWJD-UHFFFAOYSA-N
SMILES:C(Cl)C1=CN(C)C=N1
Synonyms:
  • 4-(Chloromethyl)-1-methyl-1H-imidazole
  • 1H-Imidazole, 4-(chloromethyl)-1-methyl-
  • 4-(Chloromethyl)-1-methylimidazole
Found 2 products.