CAS 112279-60-4
:4-Bromo-2,5-difluoroaniline
Description:
4-Bromo-2,5-difluoroaniline is an organic compound characterized by its aromatic amine structure, which includes a bromine atom and two fluorine atoms substituted on a benzene ring. The presence of these halogen substituents significantly influences its chemical properties, including reactivity and polarity. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The amino group (-NH2) contributes to its basicity and can engage in hydrogen bonding, affecting its solubility in different solvents. Additionally, the bromine and fluorine atoms can enhance the compound's stability and lipophilicity, making it suitable for specific synthetic pathways. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, 4-Bromo-2,5-difluoroaniline is a valuable compound in organic synthesis and material science.
Formula:C6H4BrF2N
InChI:InChI=1S/C6H4BrF2N/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,10H2
InChI key:XOYHFIQPPOJMFK-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1F)Br)F)N
Synonyms:- 4-Bromo-2,5-difluoro-phenylamine
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-Bromo-2,5-difluoroaniline
CAS:Formula:C6H4BrF2NPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:208.014-Bromo-2,5-difluoroaniline, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H4BrF2NPurity:98%Color and Shape:White to cream to brown, Crystals or powder or crystalline powderMolecular weight:208.014-Bromo-2,5-Difluoroaniline
CAS:Formula:C6H4BrF2NPurity:98%Color and Shape:SolidMolecular weight:208.00354-Bromo-2,5-difluoroaniline
CAS:4-Bromo-2,5-difluoroanilineFormula:C6H4BrF2NPurity:98%Color and Shape:SolidMolecular weight:208.003464-Bromo-2,5-difluoroaniline
CAS:4-Bromo-2,5-difluoroanilineFormula:C6H4BrF2NPurity:98%Molecular weight:208.04-Bromo-2,5-difluoroaniline
CAS:Formula:C6H4BrF2NPurity:98%Color and Shape:SolidMolecular weight:208.0064-Bromo-2,5-difluoroaniline
CAS:A useful building block for organic synthesis.Formula:C6H4BrF2NPurity:Min. 95%Molecular weight:208 g/mol






