CymitQuimica logo

CAS 112290-01-4

:

2,4-Dichloro-5-fluorobenzotrifluoride

Description:
2,4-Dichloro-5-fluorobenzotrifluoride, with the CAS number 112290-01-4, is an aromatic compound characterized by the presence of multiple halogen substituents on a benzene ring. This compound features two chlorine atoms and one fluorine atom attached to the benzene ring, along with three trifluoromethyl groups. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of halogens contributes to its chemical stability and lipophilicity, making it useful in various applications, including as an intermediate in the synthesis of agrochemicals and pharmaceuticals. Its molecular structure imparts unique properties, such as high thermal stability and resistance to degradation. Additionally, 2,4-Dichloro-5-fluorobenzotrifluoride is known for its low volatility and potential environmental persistence, which necessitates careful handling and consideration of its ecological impact. Safety data sheets should be consulted for specific handling and exposure guidelines, as halogenated compounds can pose health risks.
Formula:C7H2Cl2F4
InChI:InChI=1/C7H2Cl2F4/c8-4-2-5(9)6(10)1-3(4)7(11,12)13/h1-2H
SMILES:c1c(c(cc(c1F)Cl)Cl)C(F)(F)F
Found 2 products.