CymitQuimica logo

CAS 112290-04-7

:

Benzene, 1-bromo-4,5-difluoro-2-(trifluoromethyl)-

Description:
Benzene, 1-bromo-4,5-difluoro-2-(trifluoromethyl)-, also known by its CAS number 112290-04-7, is a halogenated aromatic compound characterized by the presence of a bromine atom and multiple fluorine substituents on a benzene ring. This compound features a trifluoromethyl group (-CF3) and two fluorine atoms at the 4 and 5 positions, while the bromine atom is located at the 1 position of the benzene ring. The presence of these electronegative halogens significantly influences its chemical properties, including increased reactivity and potential applications in organic synthesis and materials science. The compound is likely to exhibit low volatility and high stability due to the aromatic nature of the benzene ring, while its halogen substituents can enhance its polarity and solubility in certain organic solvents. Additionally, the unique combination of bromine and fluorine atoms may impart specific biological activities, making it of interest in pharmaceutical research. Safety considerations should be taken into account due to the potential toxicity associated with halogenated compounds.
Formula:C7H2BrF5
InChI:InChI=1S/C7H2BrF5/c8-4-2-6(10)5(9)1-3(4)7(11,12)13/h1-2H
InChI key:InChIKey=RYRRQLCTAKISEA-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Br)C=C(F)C(F)=C1
Synonyms:
  • 1-Bromo-4,5-difluoro-2-(trifluoromethyl)benzene
  • Benzene, 1-bromo-4,5-difluoro-2-(trifluoromethyl)-
  • 2-Bromo-4,5-difluorobenzotrifluoride
Found 2 products.