CymitQuimica logo

CAS 1123-55-3

:

7-Benzothiazolamine (9CI)

Description:
7-Benzothiazolamine, also known by its CAS number 1123-55-3, is an organic compound characterized by the presence of a benzothiazole ring fused with an amine group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. The benzothiazole moiety contributes to its unique chemical properties, such as its ability to participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. 7-Benzothiazolamine may exhibit biological activity, making it of interest in medicinal chemistry for the development of therapeutic agents. Additionally, its structural features allow for potential use as a dye or pigment in industrial applications. Safety data indicates that, like many amines, it should be handled with care due to potential toxicity and irritant properties. Overall, 7-Benzothiazolamine is a versatile compound with significant implications in both research and industrial applications.
Formula:C7H6N2S
InChI:InChI=1/C7H6N2S/c8-5-2-1-3-6-7(5)10-4-9-6/h1-4H,8H2
InChI key:ZWUIKHROIQRWGT-UHFFFAOYSA-N
SMILES:c1cc(c2c(c1)ncs2)N
Synonyms:
  • Benzo[D]Thiazol-7-Amine
  • 1,3-Benzothiazol-7-Amine
Found 4 products.