CymitQuimica logo

CAS 1123169-25-4

:

6-Bromo-2-methyl-3(2H)-pyridazinone

Description:
6-Bromo-2-methyl-3(2H)-pyridazinone is a heterocyclic organic compound characterized by its pyridazinone structure, which includes a bromine substituent at the 6-position and a methyl group at the 2-position. This compound features a five-membered ring containing two nitrogen atoms, contributing to its unique chemical properties. The presence of the bromine atom enhances its reactivity, making it a potential candidate for various chemical transformations and applications in medicinal chemistry. The methyl group can influence the compound's solubility and biological activity. Typically, pyridazinones exhibit a range of biological activities, including antimicrobial and anti-inflammatory properties, which may be relevant for pharmaceutical development. The compound's molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery. Additionally, its stability and reactivity can be influenced by the surrounding functional groups and the overall electronic environment of the molecule. Overall, 6-Bromo-2-methyl-3(2H)-pyridazinone represents a versatile scaffold in organic synthesis and medicinal chemistry.
Formula:C5H5BrN2O
InChI:InChI=1S/C5H5BrN2O/c1-8-5(9)3-2-4(6)7-8/h2-3H,1H3
InChI key:InChIKey=KDZJDTWUSLHWQN-UHFFFAOYSA-N
SMILES:CN1C(=O)C=CC(Br)=N1
Synonyms:
  • 6-Bromo-2-methyl-3(2H)-pyridazinone
  • 6-Bromo-2-methylpyridazin-3(2H)-one
  • 3(2H)-Pyridazinone, 6-bromo-2-methyl-
  • 6-Bromo-2-methylpyridazin-3-one
Found 5 products.