CymitQuimica logo

CAS 1123169-27-6

:

1-(Hydroxymethyl)cyclopropanecarboxamide

Description:
1-(Hydroxymethyl)cyclopropanecarboxamide is an organic compound characterized by its cyclopropane structure, which features a carboxamide functional group and a hydroxymethyl substituent. This compound typically exhibits properties associated with both amides and alcohols, including potential hydrogen bonding due to the presence of the hydroxymethyl group. The cyclopropane ring contributes to its unique reactivity and strain, which can influence its chemical behavior in reactions. It may be soluble in polar solvents, reflecting the hydrophilic nature of the hydroxymethyl and carboxamide groups. The compound's structure suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its specific reactivity and interactions would depend on the surrounding conditions, such as pH and temperature, as well as the presence of other functional groups in a reaction mixture. Overall, 1-(Hydroxymethyl)cyclopropanecarboxamide represents a versatile building block in organic chemistry with interesting properties stemming from its unique molecular architecture.
Formula:C5H9NO2
InChI:InChI=1S/C5H9NO2/c6-4(8)5(3-7)1-2-5/h7H,1-3H2,(H2,6,8)
InChI key:InChIKey=DTACPUNZACSGAZ-UHFFFAOYSA-N
SMILES:C(N)(=O)C1(CO)CC1
Synonyms:
  • 1-(Hydroxymethyl)cyclopropane-1-carboxamide
  • 1-(Hydroxymethyl)cyclopropanecarboxamide
  • Cyclopropanecarboxamide, 1-(hydroxymethyl)-
  • 1-Hydroxymethylcyclopropanecarboxamide
Found 4 products.