CymitQuimica logo

CAS 1123171-93-6

:

Methyl 3-bromo-5-fluoro-4-nitrobenzoate

Description:
Methyl 3-bromo-5-fluoro-4-nitrobenzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety with various substituents. The presence of a bromine atom, a fluorine atom, and a nitro group on the benzene ring contributes to its reactivity and potential applications in synthetic chemistry. The methyl ester functional group enhances its solubility in organic solvents, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound's unique combination of halogen and nitro substituents can influence its electronic properties, making it a candidate for studies in medicinal chemistry and materials science. Additionally, the presence of these functional groups may also affect its biological activity, potentially leading to applications in pharmaceuticals. As with many halogenated compounds, considerations regarding environmental impact and toxicity are important in its handling and use. Overall, Methyl 3-bromo-5-fluoro-4-nitrobenzoate serves as a versatile intermediate in organic synthesis.
Formula:C8H5BrFNO4
InChI:InChI=1S/C8H5BrFNO4/c1-15-8(12)4-2-5(9)7(11(13)14)6(10)3-4/h2-3H,1H3
InChI key:InChIKey=VTKKLEVLDPUKPD-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(Br)=C(N(=O)=O)C(F)=C1
Synonyms:
  • Benzoic acid, 3-bromo-5-fluoro-4-nitro-, methyl ester
  • Methyl 3-bromo-5-fluoro-4-nitrobenzoate
Found 4 products.