CAS 1123172-87-1

Formula: C8H5F2NO4

InChI: InChI=1S/C8H5F2NO4/c1-15-8(12)4-2-5(9)7(11(13)14)6(10)3-4/h2-3H,1H3

InChI key: XXLVODHRRUKGIV-UHFFFAOYSA-N

SMILES: COC(=O)C1=CC(=C(C(=C1)F)[N+](=O)[O-])F

Methyl 3,5-difluoro-4-nitrobenzoate

CAS: 1123172-87-1

Purity: 98%

Color and Shape: Solid

Molecular weight: 217.128006

Ref: 10-F621220

Methyl 3,5-difluoro-4-nitrobenzoate

CAS: 1123172-87-1

Methyl 3,5-difluoro-4-nitrobenzoate

Formula: C₈H₅F₂NO₄

Purity: 98%

Molecular weight: 217.13

Ref: 54-PC103251

Methyl 3,5-difluoro-4-nitrobenzoate

CAS: 1123172-87-1

Formula: C₈H₅F₂NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 217.1264

Ref: IN-DA01FR5E

Methyl 3,5-difluoro-4-nitrobenzoate

CAS: 1123172-87-1

Methyl 3,5-difluoro-4-nitrobenzoate

Formula: C₈H₅F₂NO₄

Purity: 95%

Molecular weight: 217.13

Ref: IN-DG257517