CymitQuimica logo

CAS 112370-12-4

:

Isoquinoline, 4-(3-thienyl)-

Description:
Isoquinoline, 4-(3-thienyl)- is a heterocyclic organic compound characterized by its isoquinoline backbone, which consists of a fused benzene and pyridine ring structure. The presence of a thienyl group at the 4-position introduces sulfur into the molecular framework, contributing to its unique chemical properties. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. Isoquinoline derivatives are known for their diverse biological activities, including potential applications in pharmaceuticals and agrochemicals. The thienyl substituent can influence the compound's reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks, due to the electron-rich nature of the isoquinoline ring and the presence of the thienyl group. Overall, 4-(3-thienyl)-isoquinoline represents a valuable structure for further research and development in organic synthesis and drug discovery.
Formula:C13H9NS
InChI:InChI=1S/C13H9NS/c1-2-4-12-10(3-1)7-14-8-13(12)11-5-6-15-9-11/h1-9H
InChI key:NEHUZGCWUGZUKQ-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C=NC=C2C3=CSC=C3
Found 1 products.